C18H17ClFN3O2S — CID 10271920
1-(3-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylindole (PubChem CID 10271920) has the molecular formula C18H17ClFN3O2S and a molecular weight of 393.87 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylindole.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylindole |
|---|---|
| PubChem CID | 10271920 |
| Molecular Formula | C18H17ClFN3O2S |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylindole |
| SMILES | O=S(=O)(c1ccc(F)c(Cl)c1)n1ccc2c(N3CCNCC3)cccc21 |
| InChI | InChI=1S/C18H17ClFN3O2S/c19-15-12-13(4-5-16(15)20)26(24,25)23-9-6-14-17(2-1-3-18(14)23)22-10-7-21-8-11-22/h1-6,9,12,21H,7-8,10-11H2 |
| InChIKey | KSHBYWSCYYNWNQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |