C14H15NO6S — CID 139975703
(2,5-dioxopyrrol-1-yl) 4-butoxybenzenesulfonate (PubChem CID 139975703) has the molecular formula C14H15NO6S and a molecular weight of 325.34 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 4-butoxybenzenesulfonate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 4-butoxybenzenesulfonate |
|---|---|
| PubChem CID | 139975703 |
| Molecular Formula | C14H15NO6S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 4-butoxybenzenesulfonate |
| SMILES | CCCCOc1ccc(S(=O)(=O)ON2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C14H15NO6S/c1-2-3-10-20-11-4-6-12(7-5-11)22(18,19)21-15-13(16)8-9-14(15)17/h4-9H,2-3,10H2,1H3 |
| InChIKey | UXRRRPWJHAADSL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|