About (4-octoxyphenyl) methanesulfonate
(4-octoxyphenyl) methanesulfonate (PubChem CID 174582509) has the molecular formula C15H24O4S
and a molecular weight of 300.42 g/mol. Its IUPAC name is (4-octoxyphenyl) methanesulfonate.
Molecular Properties
| Compound Name | (4-octoxyphenyl) methanesulfonate |
| PubChem CID | 174582509 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (4-octoxyphenyl) methanesulfonate |
| SMILES | CCCCCCCCOc1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24O4S/c1-3-4-5-6-7-8-13-18-14-9-11-15(12-10-14)19-20(2,16)17/h9-12H,3-8,13H2,1-2H3 |
| InChIKey | NLHGANAMBVJLPM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-octoxyphenyl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-octoxyphenyl) methanesulfonate?
The IUPAC name of (4-octoxyphenyl) methanesulfonate (CID 174582509) is (4-octoxyphenyl) methanesulfonate.
What is the SMILES notation for (4-octoxyphenyl) methanesulfonate?
The canonical SMILES for (4-octoxyphenyl) methanesulfonate is CCCCCCCCOc1ccc(OS(C)(=O)=O)cc1.
What is the InChIKey of (4-octoxyphenyl) methanesulfonate?
The InChIKey is NLHGANAMBVJLPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4S/c1-3-4-5-6-7-8-13-18-14-9-11-15(12-10-14)19-20(2,16)17/h9-12H,3-8,13H2,1-2H3.
What are the key properties of (4-octoxyphenyl) methanesulfonate?
(4-octoxyphenyl) methanesulfonate has a molecular weight of 300.42 g/mol, XLogP of 3.76, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-octoxyphenyl) methanesulfonate is sourced from PubChem (CID 174582509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).