C14H23NO4S — CID 22892949
(4-hexoxyphenyl) N,N-dimethylsulfamate (PubChem CID 22892949) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is (4-hexoxyphenyl) N,N-dimethylsulfamate.
| Compound Name | (4-hexoxyphenyl) N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 22892949 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (4-hexoxyphenyl) N,N-dimethylsulfamate |
| SMILES | CCCCCCOc1ccc(OS(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H23NO4S/c1-4-5-6-7-12-18-13-8-10-14(11-9-13)19-20(16,17)15(2)3/h8-11H,4-7,12H2,1-3H3 |
| InChIKey | IQBLWRMJHCTTEQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|