C15H10BrF2NO2S — CID 118871807
3-bromo-5,7-difluoro-1-(4-methylphenyl)sulfonylindole (PubChem CID 118871807) has the molecular formula C15H10BrF2NO2S and a molecular weight of 386.22 g/mol. Its IUPAC name is 3-bromo-5,7-difluoro-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 3-bromo-5,7-difluoro-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 118871807 |
| Molecular Formula | C15H10BrF2NO2S |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 3-bromo-5,7-difluoro-1-(4-methylphenyl)sulfonylindole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(Br)c3cc(F)cc(F)c32)cc1 |
| InChI | InChI=1S/C15H10BrF2NO2S/c1-9-2-4-11(5-3-9)22(20,21)19-8-13(16)12-6-10(17)7-14(18)15(12)19/h2-8H,1H3 |
| InChIKey | UVWAQDSXPNIJKF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |