C20H19BrN2O3S — CID 146446812
1-[3-bromo-1-(4-methylphenyl)sulfonylindol-7-yl]piperidin-2-one (PubChem CID 146446812) has the molecular formula C20H19BrN2O3S and a molecular weight of 447.35 g/mol. Its IUPAC name is 1-[3-bromo-1-(4-methylphenyl)sulfonylindol-7-yl]piperidin-2-one.
| Compound Name | 1-[3-bromo-1-(4-methylphenyl)sulfonylindol-7-yl]piperidin-2-one |
|---|---|
| PubChem CID | 146446812 |
| Molecular Formula | C20H19BrN2O3S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 1-[3-bromo-1-(4-methylphenyl)sulfonylindol-7-yl]piperidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(Br)c3cccc(N4CCCCC4=O)c32)cc1 |
| InChI | InChI=1S/C20H19BrN2O3S/c1-14-8-10-15(11-9-14)27(25,26)23-13-17(21)16-5-4-6-18(20(16)23)22-12-3-2-7-19(22)24/h4-6,8-11,13H,2-3,7,12H2,1H3 |
| InChIKey | WIZKWDIQSDKFFL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |