C11H12FN3O2S — CID 130405504
5-fluoro-3-(4-methylphenyl)sulfonyl-4H-pyrimidin-6-amine (PubChem CID 130405504) has the molecular formula C11H12FN3O2S and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-fluoro-3-(4-methylphenyl)sulfonyl-4H-pyrimidin-6-amine.
| Compound Name | 5-fluoro-3-(4-methylphenyl)sulfonyl-4H-pyrimidin-6-amine |
|---|---|
| PubChem CID | 130405504 |
| Molecular Formula | C11H12FN3O2S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 5-fluoro-3-(4-methylphenyl)sulfonyl-4H-pyrimidin-6-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2C=NC(N)=C(F)C2)cc1 |
| InChI | InChI=1S/C11H12FN3O2S/c1-8-2-4-9(5-3-8)18(16,17)15-6-10(12)11(13)14-7-15/h2-5,7H,6,13H2,1H3 |
| InChIKey | IFJBMVOOOGNPDM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |