C18H18BN5O6 — CID 176801405
N-[9-[(4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-4-yl]-6-oxo-1H-purin-2-yl]acetamide (PubChem CID 176801405) has the molecular formula C18H18BN5O6 and a molecular weight of 411.18 g/mol. Its IUPAC name is N-[9-[(4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-4-yl]-6-oxo-1H-purin-2-yl]acetamide.
| Compound Name | N-[9-[(4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-4-yl]-6-oxo-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 176801405 |
| Molecular Formula | C18H18BN5O6 |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[9-[(4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-4-yl]-6-oxo-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H]3OB(c4ccccc4)OC32)c(=O)[nH]1 |
| InChI | InChI=1S/C18H18BN5O6/c1-9(26)21-18-22-15-12(16(27)23-18)20-8-24(15)17-14-13(11(7-25)28-17)29-19(30-14)10-5-3-2-4-6-10/h2-6,8,11,13-14,17,25H,7H2,1H3,(H2,21,22,23,26,27)/t11-,13+,14?,17-/m1/s1 |
| InChIKey | GCTMTECGVGHUPA-NUKIEUHSSA-N |
| XLogP | -0.85 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|