C16H21N5O6 — CID 170586995
(E)-5-hydroxy-4-methoxy-3-[[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]methyl]pent-2-enoic acid (PubChem CID 170586995) has the molecular formula C16H21N5O6 and a molecular weight of 379.37 g/mol. Its IUPAC name is (E)-5-hydroxy-4-methoxy-3-[[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]methyl]pent-2-enoic acid.
| Compound Name | (E)-5-hydroxy-4-methoxy-3-[[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]methyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 170586995 |
| Molecular Formula | C16H21N5O6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (E)-5-hydroxy-4-methoxy-3-[[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]methyl]pent-2-enoic acid |
| SMILES | COC(CO)/C(=C/C(=O)O)Cn1cnc2c(=O)[nH]c(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C16H21N5O6/c1-8(2)14(25)19-16-18-13-12(15(26)20-16)17-7-21(13)5-9(4-11(23)24)10(6-22)27-3/h4,7-8,10,22H,5-6H2,1-3H3,(H,23,24)(H2,18,19,20,25,26)/b9-4+ |
| InChIKey | ZHBYCZWVOPYLJY-RUDMXATFSA-N |
| XLogP | -0.27 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|