C14H22N6O3 — CID 153344791
N-[9-(4-amino-3-methoxybutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 153344791) has the molecular formula C14H22N6O3 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[9-(4-amino-3-methoxybutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-(4-amino-3-methoxybutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 153344791 |
| Molecular Formula | C14H22N6O3 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[9-(4-amino-3-methoxybutyl)-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | COC(CN)CCn1cnc2c(=O)[nH]c(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C14H22N6O3/c1-8(2)12(21)18-14-17-11-10(13(22)19-14)16-7-20(11)5-4-9(6-15)23-3/h7-9H,4-6,15H2,1-3H3,(H2,17,18,19,21,22) |
| InChIKey | YNZRSBAIUKYOIK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |