C12H20IrN5O3- — CID 169190538
ethane;[9-(4-hydroxy-3-methoxybutyl)-6-oxo-1H-purin-2-yl]azanide;iridium (PubChem CID 169190538) has the molecular formula C12H20IrN5O3- and a molecular weight of 474.54 g/mol. Its IUPAC name is ethane;[9-(4-hydroxy-3-methoxybutyl)-6-oxo-1H-purin-2-yl]azanide;iridium.
| Compound Name | ethane;[9-(4-hydroxy-3-methoxybutyl)-6-oxo-1H-purin-2-yl]azanide;iridium |
|---|---|
| PubChem CID | 169190538 |
| Molecular Formula | C12H20IrN5O3- |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | ethane;[9-(4-hydroxy-3-methoxybutyl)-6-oxo-1H-purin-2-yl]azanide;iridium |
| SMILES | CC.COC(CO)CCn1cnc2c(=O)[nH]c([NH-])nc21.[Ir] |
| InChI | InChI=1S/C10H15N5O3.C2H6.Ir/c1-18-6(4-16)2-3-15-5-12-7-8(15)13-10(11)14-9(7)17;1-2;/h5-6,16H,2-4H2,1H3,(H3,11,13,14,17);1-2H3;/p-1 |
| InChIKey | QSKDCLMKZULYKP-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |