C22H36N5O10P — CID 140503718
[[(2R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 140503718) has the molecular formula C22H36N5O10P and a molecular weight of 561.53 g/mol. Its IUPAC name is [[(2R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(2R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 140503718 |
| Molecular Formula | C22H36N5O10P |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | [[(2R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(OCOC(=O)C(C)(C)C)OC[C@@H](CO)CCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C22H36N5O10P/c1-21(2,3)18(30)33-12-36-38(32,37-13-34-19(31)22(4,5)6)35-10-14(9-28)7-8-27-11-24-15-16(27)25-20(23)26-17(15)29/h11,14,28H,7-10,12-13H2,1-6H3,(H3,23,25,26,29)/t14-/m1/s1 |
| InChIKey | MFZCNRRSUIREPK-CQSZACIVSA-N |
| XLogP | 1.95 |
| TPSA | 207.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|