C15H22N6O5 — CID 142626759
[2-[(2-aminoacetyl)oxymethyl]-4-(2-amino-6-oxo-1H-purin-9-yl)butyl] propanoate (PubChem CID 142626759) has the molecular formula C15H22N6O5 and a molecular weight of 366.38 g/mol. Its IUPAC name is [2-[(2-aminoacetyl)oxymethyl]-4-(2-amino-6-oxo-1H-purin-9-yl)butyl] propanoate.
| Compound Name | [2-[(2-aminoacetyl)oxymethyl]-4-(2-amino-6-oxo-1H-purin-9-yl)butyl] propanoate |
|---|---|
| PubChem CID | 142626759 |
| Molecular Formula | C15H22N6O5 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [2-[(2-aminoacetyl)oxymethyl]-4-(2-amino-6-oxo-1H-purin-9-yl)butyl] propanoate |
| SMILES | CCC(=O)OCC(CCn1cnc2c(=O)[nH]c(N)nc21)COC(=O)CN |
| InChI | InChI=1S/C15H22N6O5/c1-2-10(22)25-6-9(7-26-11(23)5-16)3-4-21-8-18-12-13(21)19-15(17)20-14(12)24/h8-9H,2-7,16H2,1H3,(H3,17,19,20,24) |
| InChIKey | OWTVSLOOTCVVSU-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |