C16H24N6O5 — CID 142626757
[4-(2-amino-6-oxo-1H-purin-9-yl)-2-(propanoyloxymethyl)butyl] (2S)-2-aminopropanoate (PubChem CID 142626757) has the molecular formula C16H24N6O5 and a molecular weight of 380.41 g/mol. Its IUPAC name is [4-(2-amino-6-oxo-1H-purin-9-yl)-2-(propanoyloxymethyl)butyl] (2S)-2-aminopropanoate.
| Compound Name | [4-(2-amino-6-oxo-1H-purin-9-yl)-2-(propanoyloxymethyl)butyl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 142626757 |
| Molecular Formula | C16H24N6O5 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [4-(2-amino-6-oxo-1H-purin-9-yl)-2-(propanoyloxymethyl)butyl] (2S)-2-aminopropanoate |
| SMILES | CCC(=O)OCC(CCn1cnc2c(=O)[nH]c(N)nc21)COC(=O)[C@H](C)N |
| InChI | InChI=1S/C16H24N6O5/c1-3-11(23)26-6-10(7-27-15(25)9(2)17)4-5-22-8-19-12-13(22)20-16(18)21-14(12)24/h8-10H,3-7,17H2,1-2H3,(H3,18,20,21,24)/t9-,10?/m0/s1 |
| InChIKey | HXVAYMLHPWCYGC-RGURZIINSA-N |
| XLogP | -0.45 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |