C10H14FN5O2 — CID 136771556
2-amino-9-[3-((19F)fluoromethyl)-4-hydroxybutyl]-1H-purin-6-one (PubChem CID 136771556) has the molecular formula C10H14FN5O2 and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-amino-9-[3-((19F)fluoromethyl)-4-hydroxybutyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[3-((19F)fluoromethyl)-4-hydroxybutyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136771556 |
| Molecular Formula | C10H14FN5O2 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-amino-9-[3-((19F)fluoromethyl)-4-hydroxybutyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCC(CO)C[19F])c(=O)[nH]1 |
| InChI | InChI=1S/C10H14FN5O2/c11-3-6(4-17)1-2-16-5-13-7-8(16)14-10(12)15-9(7)18/h5-6,17H,1-4H2,(H3,12,14,15,18)/i11+0 |
| InChIKey | CEIVUGLBKBWVAE-DONHFQLQSA-N |
| XLogP | -0.33 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |