C11H17N5O3 — CID 136756758
2-amino-9-[(5R)-5,6-dihydroxyhexyl]-1H-purin-6-one (PubChem CID 136756758) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-amino-9-[(5R)-5,6-dihydroxyhexyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(5R)-5,6-dihydroxyhexyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136756758 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-amino-9-[(5R)-5,6-dihydroxyhexyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCCC[C@@H](O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C11H17N5O3/c12-11-14-9-8(10(19)15-11)13-6-16(9)4-2-1-3-7(18)5-17/h6-7,17-18H,1-5H2,(H3,12,14,15,19)/t7-/m1/s1 |
| InChIKey | FKGQYZIZGOWUKG-SSDOTTSWSA-N |
| XLogP | -0.77 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|