C11H16N6O4 — CID 135422925
3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2,3-dihydroxypropyl)propanamide (PubChem CID 135422925) has the molecular formula C11H16N6O4 and a molecular weight of 296.29 g/mol. Its IUPAC name is 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2,3-dihydroxypropyl)propanamide.
| Compound Name | 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2,3-dihydroxypropyl)propanamide |
|---|---|
| PubChem CID | 135422925 |
| Molecular Formula | C11H16N6O4 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2,3-dihydroxypropyl)propanamide |
| SMILES | Nc1nc2c(ncn2CCC(=O)NCC(O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C11H16N6O4/c12-11-15-9-8(10(21)16-11)14-5-17(9)2-1-7(20)13-3-6(19)4-18/h5-6,18-19H,1-4H2,(H,13,20)(H3,12,15,16,21) |
| InChIKey | JEEBTVVXMXENMO-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 159.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |