C12H14N6O3S — CID 135418394
3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2-oxothiolan-3-yl)propanamide (PubChem CID 135418394) has the molecular formula C12H14N6O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2-oxothiolan-3-yl)propanamide.
| Compound Name | 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2-oxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 135418394 |
| Molecular Formula | C12H14N6O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(2-oxothiolan-3-yl)propanamide |
| SMILES | Nc1nc2c(ncn2CCC(=O)NC2CCSC2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H14N6O3S/c13-12-16-9-8(10(20)17-12)14-5-18(9)3-1-7(19)15-6-2-4-22-11(6)21/h5-6H,1-4H2,(H,15,19)(H3,13,16,17,20) |
| InChIKey | DEKMEWXZEWLGKS-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|