C20H25N7O2 — CID 135528846
3-(2-amino-6-oxo-1H-purin-9-yl)-N-(1-benzylpiperidin-4-yl)propanamide (PubChem CID 135528846) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(1-benzylpiperidin-4-yl)propanamide.
| Compound Name | 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(1-benzylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 135528846 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-(2-amino-6-oxo-1H-purin-9-yl)-N-(1-benzylpiperidin-4-yl)propanamide |
| SMILES | Nc1nc2c(ncn2CCC(=O)NC2CCN(Cc3ccccc3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H25N7O2/c21-20-24-18-17(19(29)25-20)22-13-27(18)11-8-16(28)23-15-6-9-26(10-7-15)12-14-4-2-1-3-5-14/h1-5,13,15H,6-12H2,(H,23,28)(H3,21,24,25,29) |
| InChIKey | UXQCKQQCFUXIBL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |