About 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide
3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide (PubChem CID 15994271) has the molecular formula C30H32N4O3
and a molecular weight of 496.61 g/mol. Its IUPAC name is 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide |
| PubChem CID | 15994271 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide |
| SMILES | O=C(CCn1c(=O)c2ccccc2n(Cc2ccccc2)c1=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H32N4O3/c35-28(31-25-15-18-32(19-16-25)21-23-9-3-1-4-10-23)17-20-33-29(36)26-13-7-8-14-27(26)34(30(33)37)22-24-11-5-2-6-12-24/h1-14,25H,15-22H2,(H,31,35) |
| InChIKey | LUKWKZDXURZRMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide?
The IUPAC name of 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide (CID 15994271) is 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide.
What is the SMILES notation for 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide?
The canonical SMILES for 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide is O=C(CCn1c(=O)c2ccccc2n(Cc2ccccc2)c1=O)NC1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide?
The InChIKey is LUKWKZDXURZRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N4O3/c35-28(31-25-15-18-32(19-16-25)21-23-9-3-1-4-10-23)17-20-33-29(36)26-13-7-8-14-27(26)34(30(33)37)22-24-11-5-2-6-12-24/h1-14,25H,15-22H2,(H,31,35).
What are the key properties of 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide?
3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide has a molecular weight of 496.61 g/mol, XLogP of 3.38, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzyl-2,4-dioxoquinazolin-3-yl)-N-(1-benzylpiperidin-4-yl)propanamide is sourced from PubChem (CID 15994271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).