C24H28N6O2 — CID 176780617
N-[4-(1-adamantyl)phenyl]-3-(2-amino-6-oxo-1H-purin-9-yl)propanamide (PubChem CID 176780617) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-3-(2-amino-6-oxo-1H-purin-9-yl)propanamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-3-(2-amino-6-oxo-1H-purin-9-yl)propanamide |
|---|---|
| PubChem CID | 176780617 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-3-(2-amino-6-oxo-1H-purin-9-yl)propanamide |
| SMILES | Nc1nc2c(ncn2CCC(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H28N6O2/c25-23-28-21-20(22(32)29-23)26-13-30(21)6-5-19(31)27-18-3-1-17(2-4-18)24-10-14-7-15(11-24)9-16(8-14)12-24/h1-4,13-16H,5-12H2,(H,27,31)(H3,25,28,29,32) |
| InChIKey | SXUQKKANENGMQG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |