C24H27N5O3 — CID 176780615
N-[4-(1-adamantyl)phenyl]-3-(2,6-dioxo-3H-purin-9-yl)propanamide (PubChem CID 176780615) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-3-(2,6-dioxo-3H-purin-9-yl)propanamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-3-(2,6-dioxo-3H-purin-9-yl)propanamide |
|---|---|
| PubChem CID | 176780615 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-3-(2,6-dioxo-3H-purin-9-yl)propanamide |
| SMILES | O=C(CCn1cnc2c(=O)[nH]c(=O)[nH]c21)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H27N5O3/c30-19(5-6-29-13-25-20-21(29)27-23(32)28-22(20)31)26-18-3-1-17(2-4-18)24-10-14-7-15(11-24)9-16(8-14)12-24/h1-4,13-16H,5-12H2,(H,26,30)(H2,27,28,31,32) |
| InChIKey | QSLVJPPOSZXURQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |