C21H26N4OS — CID 126739252
N-[4-(1-adamantyl)phenyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide (PubChem CID 126739252) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 126739252 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
| SMILES | O=C(CCSc1ncn[nH]1)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H26N4OS/c26-19(5-6-27-20-22-13-23-25-20)24-18-3-1-17(2-4-18)21-10-14-7-15(11-21)9-16(8-14)12-21/h1-4,13-16H,5-12H2,(H,24,26)(H,22,23,25) |
| InChIKey | XHBLMZAZFIYOFG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |