C14H20N4O — CID 17285399
2-(1-adamantyl)-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 17285399) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 17285399 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-(1-adamantyl)-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1ncn[nH]1 |
| InChI | InChI=1S/C14H20N4O/c19-12(17-13-15-8-16-18-13)7-14-4-9-1-10(5-14)3-11(2-9)6-14/h8-11H,1-7H2,(H2,15,16,17,18,19) |
| InChIKey | RFTNHQKQUYRZKZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |