C14H21N5O — CID 108870431
1-(1-adamantylmethyl)-3-(1H-1,2,4-triazol-5-yl)urea (PubChem CID 108870431) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-(1H-1,2,4-triazol-5-yl)urea.
| Compound Name | 1-(1-adamantylmethyl)-3-(1H-1,2,4-triazol-5-yl)urea |
|---|---|
| PubChem CID | 108870431 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-(1H-1,2,4-triazol-5-yl)urea |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)Nc1ncn[nH]1 |
| InChI | InChI=1S/C14H21N5O/c20-13(18-12-16-8-17-19-12)15-7-14-4-9-1-10(5-14)3-11(2-9)6-14/h8-11H,1-7H2,(H3,15,16,17,18,19,20) |
| InChIKey | RALNCAJJWUQJTN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |