C6H10N4O — CID 5020131
N-(1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 5020131) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | N-(1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 5020131 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | CCCC(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C6H10N4O/c1-2-3-5(11)9-6-7-4-8-10-6/h4H,2-3H2,1H3,(H2,7,8,9,10,11) |
| InChIKey | IALIDNKBQBJWAE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |