C13H17N5O3S — CID 2216075
4-[benzenesulfonyl(methyl)amino]-N-(1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 2216075) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-[benzenesulfonyl(methyl)amino]-N-(1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | 4-[benzenesulfonyl(methyl)amino]-N-(1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 2216075 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-[benzenesulfonyl(methyl)amino]-N-(1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | CN(CCCC(=O)Nc1ncn[nH]1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17N5O3S/c1-18(22(20,21)11-6-3-2-4-7-11)9-5-8-12(19)16-13-14-10-15-17-13/h2-4,6-7,10H,5,8-9H2,1H3,(H2,14,15,16,17,19) |
| InChIKey | SZDRXLHIDBBBPY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |