C10H12N4OS — CID 30866887
4-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 30866887) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | 4-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 30866887 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | O=C(CCCc1cccs1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C10H12N4OS/c15-9(13-10-11-7-12-14-10)5-1-3-8-4-2-6-16-8/h2,4,6-7H,1,3,5H2,(H2,11,12,13,14,15) |
| InChIKey | DUGKSFXCUGZQBQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |