C7H11ClN4O — CID 63665630
5-chloro-N-(1H-1,2,4-triazol-5-yl)pentanamide (PubChem CID 63665630) has the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. Its IUPAC name is 5-chloro-N-(1H-1,2,4-triazol-5-yl)pentanamide.
| Compound Name | 5-chloro-N-(1H-1,2,4-triazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 63665630 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 5-chloro-N-(1H-1,2,4-triazol-5-yl)pentanamide |
| SMILES | O=C(CCCCCl)Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H11ClN4O/c8-4-2-1-3-6(13)11-7-9-5-10-12-7/h5H,1-4H2,(H2,9,10,11,12,13) |
| InChIKey | VHQSFPRWINYVLE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|