C14H24N4O2 — CID 56696523
5-oxo-N-(1H-1,2,4-triazol-5-yl)dodecanamide (PubChem CID 56696523) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-oxo-N-(1H-1,2,4-triazol-5-yl)dodecanamide.
| Compound Name | 5-oxo-N-(1H-1,2,4-triazol-5-yl)dodecanamide |
|---|---|
| PubChem CID | 56696523 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 5-oxo-N-(1H-1,2,4-triazol-5-yl)dodecanamide |
| SMILES | CCCCCCCC(=O)CCCC(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C14H24N4O2/c1-2-3-4-5-6-8-12(19)9-7-10-13(20)17-14-15-11-16-18-14/h11H,2-10H2,1H3,(H2,15,16,17,18,20) |
| InChIKey | IBTUYFKJCYSBKM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|