C14H13N5O3S2 — CID 47082947
4-(thiophen-2-ylmethylsulfamoyl)-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 47082947) has the molecular formula C14H13N5O3S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-(thiophen-2-ylmethylsulfamoyl)-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 4-(thiophen-2-ylmethylsulfamoyl)-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 47082947 |
| Molecular Formula | C14H13N5O3S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 4-(thiophen-2-ylmethylsulfamoyl)-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc(S(=O)(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C14H13N5O3S2/c20-13(18-14-15-9-16-19-14)10-3-5-12(6-4-10)24(21,22)17-8-11-2-1-7-23-11/h1-7,9,17H,8H2,(H2,15,16,18,19,20) |
| InChIKey | IPHCXWWBYZAAPY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |