C18H19N5O3S3 — CID 56547069
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 56547069) has the molecular formula C18H19N5O3S3 and a molecular weight of 449.58 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 56547069 |
| Molecular Formula | C18H19N5O3S3 |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCc1n[nH]c(=S)n1C1CC1)c1ccc(S(=O)(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C18H19N5O3S3/c24-17(19-11-16-21-22-18(27)23(16)13-5-6-13)12-3-7-15(8-4-12)29(25,26)20-10-14-2-1-9-28-14/h1-4,7-9,13,20H,5-6,10-11H2,(H,19,24)(H,22,27) |
| InChIKey | FNQWVVRAJMPZEE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|