C19H26N4O4S — CID 56537982
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,4,5-triethoxybenzamide (PubChem CID 56537982) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 56537982 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2n[nH]c(=S)n2C2CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H26N4O4S/c1-4-25-14-9-12(10-15(26-5-2)17(14)27-6-3)18(24)20-11-16-21-22-19(28)23(16)13-7-8-13/h9-10,13H,4-8,11H2,1-3H3,(H,20,24)(H,22,28) |
| InChIKey | KIRNGAOUROFVGX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|