C16H22ClN3O3S2 — CID 119505533
N-[2-(ethylamino)ethyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119505533) has the molecular formula C16H22ClN3O3S2 and a molecular weight of 403.96 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119505533 |
| Molecular Formula | C16H22ClN3O3S2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-(thiophen-2-ylmethylsulfamoyl)benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccc(S(=O)(=O)NCc2cccs2)cc1.Cl |
| InChI | InChI=1S/C16H21N3O3S2.ClH/c1-2-17-9-10-18-16(20)13-5-7-15(8-6-13)24(21,22)19-12-14-4-3-11-23-14;/h3-8,11,17,19H,2,9-10,12H2,1H3,(H,18,20);1H |
| InChIKey | RZYKHAUCQKRTBL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|