C12H14N4OS — CID 8797908
3-benzylsulfanyl-N-(1H-1,2,4-triazol-5-yl)propanamide (PubChem CID 8797908) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-(1H-1,2,4-triazol-5-yl)propanamide.
| Compound Name | 3-benzylsulfanyl-N-(1H-1,2,4-triazol-5-yl)propanamide |
|---|---|
| PubChem CID | 8797908 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-benzylsulfanyl-N-(1H-1,2,4-triazol-5-yl)propanamide |
| SMILES | O=C(CCSCc1ccccc1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C12H14N4OS/c17-11(15-12-13-9-14-16-12)6-7-18-8-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H2,13,14,15,16,17) |
| InChIKey | JXUDEYGQVBQKLJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|