C11H11BrN4OS — CID 113385200
3-bromo-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide (PubChem CID 113385200) has the molecular formula C11H11BrN4OS and a molecular weight of 327.21 g/mol. Its IUPAC name is 3-bromo-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide.
| Compound Name | 3-bromo-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide |
|---|---|
| PubChem CID | 113385200 |
| Molecular Formula | C11H11BrN4OS |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 3-bromo-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide |
| SMILES | O=C(CCBr)Nc1ccc(Sc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C11H11BrN4OS/c12-6-5-10(17)15-8-1-3-9(4-2-8)18-11-13-7-14-16-11/h1-4,7H,5-6H2,(H,15,17)(H,13,14,16) |
| InChIKey | WAJBNEZHZVLVGM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|