C12H15N5OS — CID 43712450
2-amino-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butanamide (PubChem CID 43712450) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-amino-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butanamide.
| Compound Name | 2-amino-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 43712450 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-amino-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]butanamide |
| SMILES | CCC(N)C(=O)Nc1ccc(Sc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H15N5OS/c1-2-10(13)11(18)16-8-3-5-9(6-4-8)19-12-14-7-15-17-12/h3-7,10H,2,13H2,1H3,(H,16,18)(H,14,15,17) |
| InChIKey | BOJYHLCTDZLRQN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |