About N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline
N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline (PubChem CID 43729172) has the molecular formula C15H22N4S
and a molecular weight of 290.44 g/mol. Its IUPAC name is N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline.
Molecular Properties
| Compound Name | N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline |
| PubChem CID | 43729172 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline |
| SMILES | CCCCCC(C)Nc1ccc(Sc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C15H22N4S/c1-3-4-5-6-12(2)18-13-7-9-14(10-8-13)20-15-16-11-17-19-15/h7-12,18H,3-6H2,1-2H3,(H,16,17,19) |
| InChIKey | QBBUGIVQKTVWDR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline?
The IUPAC name of N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline (CID 43729172) is N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline.
What is the SMILES notation for N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline?
The canonical SMILES for N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline is CCCCCC(C)Nc1ccc(Sc2ncn[nH]2)cc1.
What is the InChIKey of N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline?
The InChIKey is QBBUGIVQKTVWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4S/c1-3-4-5-6-12(2)18-13-7-9-14(10-8-13)20-15-16-11-17-19-15/h7-12,18H,3-6H2,1-2H3,(H,16,17,19).
What are the key properties of N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline?
N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline has a molecular weight of 290.44 g/mol, XLogP of 4.34, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-2-yl-4-(1H-1,2,4-triazol-5-ylsulfanyl)aniline is sourced from PubChem (CID 43729172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).