C12H14N4O2S — CID 115588518
2-methoxy-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide (PubChem CID 115588518) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-methoxy-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide.
| Compound Name | 2-methoxy-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide |
|---|---|
| PubChem CID | 115588518 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-methoxy-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propanamide |
| SMILES | COC(C)C(=O)Nc1ccc(Sc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H14N4O2S/c1-8(18-2)11(17)15-9-3-5-10(6-4-9)19-12-13-7-14-16-12/h3-8H,1-2H3,(H,15,17)(H,13,14,16) |
| InChIKey | SUMCYQPKJRXJRX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |