C15H14N6O4 — CID 135515441
4-[3-(2-amino-6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid (PubChem CID 135515441) has the molecular formula C15H14N6O4 and a molecular weight of 342.32 g/mol. Its IUPAC name is 4-[3-(2-amino-6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid.
| Compound Name | 4-[3-(2-amino-6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 135515441 |
| Molecular Formula | C15H14N6O4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-[3-(2-amino-6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid |
| SMILES | Nc1nc2c(ncn2CCC(=O)Nc2ccc(C(=O)O)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H14N6O4/c16-15-19-12-11(13(23)20-15)17-7-21(12)6-5-10(22)18-9-3-1-8(2-4-9)14(24)25/h1-4,7H,5-6H2,(H,18,22)(H,24,25)(H3,16,19,20,23) |
| InChIKey | AKUDYIOEMKDMHQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |