C16H13N5O3 — CID 135524551
4-(2-amino-6-oxo-1H-purin-9-yl)but-2-ynyl benzoate (PubChem CID 135524551) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 4-(2-amino-6-oxo-1H-purin-9-yl)but-2-ynyl benzoate.
| Compound Name | 4-(2-amino-6-oxo-1H-purin-9-yl)but-2-ynyl benzoate |
|---|---|
| PubChem CID | 135524551 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-(2-amino-6-oxo-1H-purin-9-yl)but-2-ynyl benzoate |
| SMILES | Nc1nc2c(ncn2CC#CCOC(=O)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H13N5O3/c17-16-19-13-12(14(22)20-16)18-10-21(13)8-4-5-9-24-15(23)11-6-2-1-3-7-11/h1-3,6-7,10H,8-9H2,(H3,17,19,20,22) |
| InChIKey | ZWWBJEDZEACIEM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|