C16H13N5O2 — CID 10335357
4-(6-aminopurin-9-yl)but-2-ynyl benzoate (PubChem CID 10335357) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)but-2-ynyl benzoate.
| Compound Name | 4-(6-aminopurin-9-yl)but-2-ynyl benzoate |
|---|---|
| PubChem CID | 10335357 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-(6-aminopurin-9-yl)but-2-ynyl benzoate |
| SMILES | Nc1ncnc2c1ncn2CC#CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13N5O2/c17-14-13-15(19-10-18-14)21(11-20-13)8-4-5-9-23-16(22)12-6-2-1-3-7-12/h1-3,6-7,10-11H,8-9H2,(H2,17,18,19) |
| InChIKey | ZNJFFHQUJHMUGU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|