C25H23N5O4 — CID 14236877
[2-[(6-aminopurin-9-yl)methyl]-1-(benzoyloxymethyl)cyclopropyl]methyl benzoate (PubChem CID 14236877) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is [2-[(6-aminopurin-9-yl)methyl]-1-(benzoyloxymethyl)cyclopropyl]methyl benzoate.
| Compound Name | [2-[(6-aminopurin-9-yl)methyl]-1-(benzoyloxymethyl)cyclopropyl]methyl benzoate |
|---|---|
| PubChem CID | 14236877 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [2-[(6-aminopurin-9-yl)methyl]-1-(benzoyloxymethyl)cyclopropyl]methyl benzoate |
| SMILES | Nc1ncnc2c1ncn2CC1CC1(COC(=O)c1ccccc1)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23N5O4/c26-21-20-22(28-15-27-21)30(16-29-20)12-19-11-25(19,13-33-23(31)17-7-3-1-4-8-17)14-34-24(32)18-9-5-2-6-10-18/h1-10,15-16,19H,11-14H2,(H2,26,27,28) |
| InChIKey | SWPSTJXKIUJJQF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |