C17H16N6O3 — CID 10970206
[(1S,2S,5S)-1-(6-aminopurin-9-yl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]methyl benzoate (PubChem CID 10970206) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is [(1S,2S,5S)-1-(6-aminopurin-9-yl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]methyl benzoate.
| Compound Name | [(1S,2S,5S)-1-(6-aminopurin-9-yl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10970206 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(1S,2S,5S)-1-(6-aminopurin-9-yl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
| SMILES | Nc1ncnc2c1ncn2[C@@]12N[C@@H]1CO[C@@H]2COC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N6O3/c18-14-13-15(20-8-19-14)23(9-21-13)17-11(22-17)6-25-12(17)7-26-16(24)10-4-2-1-3-5-10/h1-5,8-9,11-12,22H,6-7H2,(H2,18,19,20)/t11-,12-,17+/m1/s1 |
| InChIKey | FRWNYMROXHPCLW-QFSBIZTOSA-N |
| XLogP | 0.29 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|