C22H28N5O5P — CID 57161599
[(2S,5R)-5-(6-aminopurin-9-yl)-3-(diethoxyphosphanylmethyl)oxolan-2-yl]methyl benzoate (PubChem CID 57161599) has the molecular formula C22H28N5O5P and a molecular weight of 473.47 g/mol. Its IUPAC name is [(2S,5R)-5-(6-aminopurin-9-yl)-3-(diethoxyphosphanylmethyl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,5R)-5-(6-aminopurin-9-yl)-3-(diethoxyphosphanylmethyl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 57161599 |
| Molecular Formula | C22H28N5O5P |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [(2S,5R)-5-(6-aminopurin-9-yl)-3-(diethoxyphosphanylmethyl)oxolan-2-yl]methyl benzoate |
| SMILES | CCOP(CC1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COC(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C22H28N5O5P/c1-3-30-33(31-4-2)12-16-10-18(27-14-26-19-20(23)24-13-25-21(19)27)32-17(16)11-29-22(28)15-8-6-5-7-9-15/h5-9,13-14,16-18H,3-4,10-12H2,1-2H3,(H2,23,24,25)/t16?,17-,18-/m1/s1 |
| InChIKey | MXNABYYTNLARCQ-UKKPGEIXSA-N |
| XLogP | 3.55 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|