C24H21N5O5S — CID 42614942
[(2R,3S)-2-(6-aminopurin-9-yl)-4-(benzoyloxymethyl)-1-oxothietan-3-yl]methyl benzoate (PubChem CID 42614942) has the molecular formula C24H21N5O5S and a molecular weight of 491.53 g/mol. Its IUPAC name is [(2R,3S)-2-(6-aminopurin-9-yl)-4-(benzoyloxymethyl)-1-oxothietan-3-yl]methyl benzoate.
| Compound Name | [(2R,3S)-2-(6-aminopurin-9-yl)-4-(benzoyloxymethyl)-1-oxothietan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 42614942 |
| Molecular Formula | C24H21N5O5S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | [(2R,3S)-2-(6-aminopurin-9-yl)-4-(benzoyloxymethyl)-1-oxothietan-3-yl]methyl benzoate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1[C@@H](COC(=O)c2ccccc2)C(COC(=O)c2ccccc2)S1=O |
| InChI | InChI=1S/C24H21N5O5S/c25-20-19-21(27-13-26-20)29(14-28-19)22-17(11-33-23(30)15-7-3-1-4-8-15)18(35(22)32)12-34-24(31)16-9-5-2-6-10-16/h1-10,13-14,17-18,22H,11-12H2,(H2,25,26,27)/t17-,18?,22+,35?/m0/s1 |
| InChIKey | GHOZWRGUYFCGCW-KONOSYJFSA-N |
| XLogP | 2.37 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |