C18H13ClF2N4O3 — CID 102039381
[(2R,6R)-6-(6-chloropurin-9-yl)-3,3-difluoro-2,6-dihydropyran-2-yl]methyl benzoate (PubChem CID 102039381) has the molecular formula C18H13ClF2N4O3 and a molecular weight of 406.78 g/mol. Its IUPAC name is [(2R,6R)-6-(6-chloropurin-9-yl)-3,3-difluoro-2,6-dihydropyran-2-yl]methyl benzoate.
| Compound Name | [(2R,6R)-6-(6-chloropurin-9-yl)-3,3-difluoro-2,6-dihydropyran-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102039381 |
| Molecular Formula | C18H13ClF2N4O3 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | [(2R,6R)-6-(6-chloropurin-9-yl)-3,3-difluoro-2,6-dihydropyran-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)C=CC1(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H13ClF2N4O3/c19-15-14-16(23-9-22-15)25(10-24-14)13-6-7-18(20,21)12(28-13)8-27-17(26)11-4-2-1-3-5-11/h1-7,9-10,12-13H,8H2/t12-,13-/m1/s1 |
| InChIKey | WXIARYNKPQFMEG-CHWSQXEVSA-N |
| XLogP | 3.43 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|