C16H13ClN4O3S — CID 11326379
[(2S,5R)-5-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methyl benzoate (PubChem CID 11326379) has the molecular formula C16H13ClN4O3S and a molecular weight of 376.83 g/mol. Its IUPAC name is [(2S,5R)-5-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methyl benzoate.
| Compound Name | [(2S,5R)-5-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11326379 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | [(2S,5R)-5-(6-chloropurin-9-yl)-1,3-oxathiolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)CS1)c1ccccc1 |
| InChI | InChI=1S/C16H13ClN4O3S/c17-14-13-15(19-8-18-14)21(9-20-13)11-7-25-12(24-11)6-23-16(22)10-4-2-1-3-5-10/h1-5,8-9,11-12H,6-7H2/t11-,12+/m1/s1 |
| InChIKey | WSVWQLBJZNMCHA-NEPJUHHUSA-N |
| XLogP | 2.92 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |