C17H16ClN5O3 — CID 11222561
[5-(2-amino-6-chloropurin-9-yl)oxolan-3-yl]methyl benzoate (PubChem CID 11222561) has the molecular formula C17H16ClN5O3 and a molecular weight of 373.80 g/mol. Its IUPAC name is [5-(2-amino-6-chloropurin-9-yl)oxolan-3-yl]methyl benzoate.
| Compound Name | [5-(2-amino-6-chloropurin-9-yl)oxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 11222561 |
| Molecular Formula | C17H16ClN5O3 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [5-(2-amino-6-chloropurin-9-yl)oxolan-3-yl]methyl benzoate |
| SMILES | Nc1nc(Cl)c2ncn(C3CC(COC(=O)c4ccccc4)CO3)c2n1 |
| InChI | InChI=1S/C17H16ClN5O3/c18-14-13-15(22-17(19)21-14)23(9-20-13)12-6-10(7-25-12)8-26-16(24)11-4-2-1-3-5-11/h1-5,9-10,12H,6-8H2,(H2,19,21,22) |
| InChIKey | KJGMXDGGLSECNX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |