C25H20Cl2N4O4 — CID 58444213
[2-(benzoyloxymethyl)-3-(2,6-dichloropurin-9-yl)cyclobutyl]methyl benzoate (PubChem CID 58444213) has the molecular formula C25H20Cl2N4O4 and a molecular weight of 511.37 g/mol. Its IUPAC name is [2-(benzoyloxymethyl)-3-(2,6-dichloropurin-9-yl)cyclobutyl]methyl benzoate.
| Compound Name | [2-(benzoyloxymethyl)-3-(2,6-dichloropurin-9-yl)cyclobutyl]methyl benzoate |
|---|---|
| PubChem CID | 58444213 |
| Molecular Formula | C25H20Cl2N4O4 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | [2-(benzoyloxymethyl)-3-(2,6-dichloropurin-9-yl)cyclobutyl]methyl benzoate |
| SMILES | O=C(OCC1CC(n2cnc3c(Cl)nc(Cl)nc32)C1COC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20Cl2N4O4/c26-21-20-22(30-25(27)29-21)31(14-28-20)19-11-17(12-34-23(32)15-7-3-1-4-8-15)18(19)13-35-24(33)16-9-5-2-6-10-16/h1-10,14,17-19H,11-13H2 |
| InChIKey | YQAZJMMYVGGUDW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |